|
|
| | 2-Bromophenylhydrazine hydrochloride Basic information |
| | 2-Bromophenylhydrazine hydrochloride Chemical Properties |
| Melting point | 189 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | slightly sol. in Methanol | | form | powder to crystal | | color | White to Light yellow to Light orange | | Sensitive | Hygroscopic | | BRN | 3628612 | | InChI | InChI=1S/C6H7BrN2.ClH/c7-5-3-1-2-4-6(5)9-8;/h1-4,9H,8H2;1H | | InChIKey | PHCYUJRYSFMJMG-UHFFFAOYSA-N | | SMILES | C1(NN)=CC=CC=C1Br.Cl | | CAS DataBase Reference | 50709-33-6(CAS DataBase Reference) |
| Hazard Codes | C,Xn | | Risk Statements | 34-20/21-31-20 | | Safety Statements | 26-27-36/37/39-45-23 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | PackingGroup | Ⅱ | | HS Code | 29280000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Bromophenylhydrazine hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 2-Bromophenylhydrazine hydrochloride was used to prepare 6-(3-bromophenylhydrazono)-7,8,9,11-tetrahydropyrido[2,1-b]quinazoline-11-one. |
| | 2-Bromophenylhydrazine hydrochloride Preparation Products And Raw materials |
|