| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Citric-2,4-13C2 acid Basic information |
| | Citric-2,4-13C2 acid Chemical Properties |
| Melting point | 153-159 °C (lit.) | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | 1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1+1,2+1 | | InChIKey | KRKNYBCHXYNGOX-ZDOIIHCHSA-N | | SMILES | OC(=O)[13CH2]C(O)([13CH2]C(O)=O)C(O)=O | | CAS Number Unlabeled | 77-92-9 |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-36-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 STOT SE 3 |
| | Citric-2,4-13C2 acid Usage And Synthesis |
| Uses | Citric acid-2,4-13C2 is an isotopic analog of citric acid (C521000), a component of the Krebs cycle. |
| | Citric-2,4-13C2 acid Preparation Products And Raw materials |
|