|
|
| | 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE Basic information |
| Product Name: | 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE | | Synonyms: | 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE;6-Bromo-2-chloro-1H-benzoimidazole;5-Bromo-2-chlorobenzimidazole;6-bromo-2-chloro-1H-benzimidazole;5-bromo-2-chloro-1H-1,3-benzodiazole;1H-Benzimidazole, 6-bromo-2-chloro-;6-Bromo-2-chlorobenzimidazole;5-Bromo-2-chloro-1H-1,3-benzimidazole | | CAS: | 683240-76-8 | | MF: | C7H4BrClN2 | | MW: | 231.48 | | EINECS: | | | Product Categories: | | | Mol File: | 683240-76-8.mol |  |
| | 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE Chemical Properties |
| Melting point | 212-213° | | Boiling point | 387.3±34.0 °C(Predicted) | | density | 1.878 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | pka | 8.56±0.10(Predicted) | | color | Off white to faint lemon | | InChI | 1S/C7H4BrClN2/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H,10,11) | | InChIKey | QVVZVWKGWGFUTA-UHFFFAOYSA-N | | SMILES | ClC(N1[H])=NC2=C1C=CC(Br)=C2 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE Usage And Synthesis |
| Anticancer Research | 5-Bromo-2-chloro-1H-benzimidazole is used as a potential anti-cancer
agent for its potential to target and treat cancer cells. Its specific
mechanism of action and efficacy in combating cancer are areas of
ongoing research. |
| | 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE Preparation Products And Raw materials |
|