|
|
| | 5-Bromo-2-chlorobenzonitrile Basic information |
| | 5-Bromo-2-chlorobenzonitrile Chemical Properties |
| Melting point | 133 °C | | Boiling point | 266.9±20.0 °C(Predicted) | | density | 1.74±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C7H3BrClN/c8-6-1-2-7(9)5(3-6)4-10/h1-3H | | InChIKey | NKDMQBUJOXQVEA-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(Br)=CC=C1Cl | | CAS DataBase Reference | 57381-44-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 3439 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 |
| | 5-Bromo-2-chlorobenzonitrile Usage And Synthesis |
| Uses | 5-Bromo-2-chlorobenzonitrile is an organic reagent used in the preparation of novel thiazolidin-4-ones as HIV-1 fusion inhibitors targetting gp41. Also used in the synthesis of diazinones as P2 replacements for pyrazole-based cathespin S inhibitors. |
| | 5-Bromo-2-chlorobenzonitrile Preparation Products And Raw materials |
|