|
|
| | 2-Methyl-3-nitropyridine Basic information |
| Product Name: | 2-Methyl-3-nitropyridine | | Synonyms: | 3-NITRO-2-PICOLINE;3-NITRO-2-METHYLPYRIDINE;2-METHYL-3-NITROPYRIDINE;2-Methyl-3-nitropyri;Pyridine, 2-methyl-3-nitro- (9CI);3-Nitro-2-methylpyridine
3-Nitro-2-picoline;2-METHYL-3-NITROPYRIDINE 95%;3-NITROPICOLINE | | CAS: | 18699-87-1 | | MF: | C6H6N2O2 | | MW: | 138.12 | | EINECS: | 805-108-9 | | Product Categories: | Pyridines;Pyridine;NITRO | | Mol File: | 18699-87-1.mol |  |
| | 2-Methyl-3-nitropyridine Chemical Properties |
| Melting point | 32-33° | | Boiling point | 86°C/5mmHg(lit.) | | density | 1.246±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to lump | | pka | 1.92±0.10(Predicted) | | color | Light yellow to Brown | | InChI | InChI=1S/C6H6N2O2/c1-5-6(8(9)10)3-2-4-7-5/h2-4H,1H3 | | InChIKey | CCFGTKQIRWHYTB-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 18699-87-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2-Methyl-3-nitropyridine Usage And Synthesis |
| Uses | 2-Methyl-3-nitropyridine is used as a starting reagent to synthesize 3-substituted-4 or 6-azaindoles, and is also used as a reagent to prepare 3-azaindolyl-4-arylmalemides (compounds that exhibit antiproliferative activity). | | Reactions | 2-Methyl-3-nitropyridine could be used to synthesize dichloro-(3-nitro-2-pyridyl)methylphosphonic dichloride. The chlorination of 2-methyl-3-nitropyridine using a mixture of PCl5 in POCl3[1].
 | | Synthesis Reference(s) | Tetrahedron, 54, p. 6311, 1998 DOI: 10.1016/S0040-4020(98)00328-7 Journal of Heterocyclic Chemistry, 29, p. 359, 1992 DOI: 10.1002/jhet.5570290213 Synthetic Communications, 20, p. 2965, 1990 DOI: 10.1080/00397919008051513 | | Synthesis | Suzuki Reaction. A mixture of 2-chloro-3-nitro-pyridine 1 (793 mg, 5 mmol), methylboronic acid (329 mg, 5.5 mmol), Pd(PPh3) 4 (578 mg, 0.5 mmol) and K2CO 3 (2.073 g, 15 retool) in dioxane (25 mL) was refluxed for 2 days, then cooled to room temperature and filtered. The solvent was removed and the residue was isolated by chromatography (hexanes-EtOAc = 1:1) to provide 623 mg (90%) of 2-methyl-3-nitropyridine[2].
| | References | [1] Amrane D, et al. "Dichloro{4-(4-chlorophenoxy)phthalazin-1-yl} methylphosphonic dichloride." Molbank (2022). [2] Niu, Chuansheng , et al. "Synthesis of 3-aminopyridine-2-carboxaldehyde thiosemicarbazone (3-AP)." 54.23(1998):6311-6318. |
| | 2-Methyl-3-nitropyridine Preparation Products And Raw materials |
|