- Z-DL-ALA-OH
-
- $1.00
-
2025-12-12
- CAS:4132-86-9
- Min. Order: 1KG
- Purity: 99%+
- Supply Ability: 980KG
- Z-DL-ALA-OH
-
- $2.00
-
2020-01-10
- CAS:4132-86-9
- Min. Order: 1g
- Purity: 98%MIN
|
| | Z-DL-ALA-OH Basic information |
| | Z-DL-ALA-OH Chemical Properties |
| Melting point | 112-113 °C(lit.) | | Boiling point | 364.51°C (rough estimate) | | density | 1.2446 (rough estimate) | | refractive index | 1.4960 (estimate) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | almost transparency in Methanol | | form | powder to crystal | | pka | 4.00±0.10(Predicted) | | color | White to Almost white | | BRN | 6847292 | | Major Application | peptide synthesis | | InChI | 1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14) | | InChIKey | TYRGLVWXHJRKMT-UHFFFAOYSA-N | | SMILES | CC(NC(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 4132-86-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Z-DL-ALA-OH Usage And Synthesis |
| Chemical Properties | white powder | | Uses | peptide synthesis | | Synthesis Reference(s) | Synthetic Communications, 25, p. 553, 1995 DOI: 10.1080/00397919508011389 | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-DL-ALA-OH Preparation Products And Raw materials |
|