| Company Name: |
Elucigen bio Gold |
| Tel: |
13501719342 13501719342 |
| Email: |
wayne.zheng@elucigenbio.com |
|
| | 3-Amino-2-ethoxycarbonylpyrrole hydrochloride Basic information |
| | 3-Amino-2-ethoxycarbonylpyrrole hydrochloride Chemical Properties |
| Melting point | 198-204°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H10N2O2.ClH/c1-2-11-7(10)6-5(8)3-4-9-6;/h3-4,9H,2,8H2,1H3;1H | | InChIKey | MWWQOUGXCWIOSR-UHFFFAOYSA-N | | SMILES | C(C1NC=CC=1N)(=O)OCC.Cl | | CAS DataBase Reference | 252932-49-3(CAS DataBase Reference) |
| | 3-Amino-2-ethoxycarbonylpyrrole hydrochloride Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 3-Amino-2-ethoxycarbonylpyrrole hydrochloride can be used as an organic synthesis intermediate in the field of pharmaceutical research and development, particularly playing an important role in chemical biology areas such as the construction of complex molecules and the study of enzyme interactions. |
| | 3-Amino-2-ethoxycarbonylpyrrole hydrochloride Preparation Products And Raw materials |
|