| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | MN(TMHD)3 Basic information |
| Product Name: | MN(TMHD)3 | | Synonyms: | MN(TMHD)3;TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)MANGANESE (III);Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)manganese (III), (Mn(TMHD)3);TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)MANGANESE (III) 99% [MN(TMHD)3];Bis-(2,2,6,6-tetramethyl-3,5-heptandionato)manganese(II);Tris(2,2,6,6-tetramethyl-3,5-heptanedionate) manganese (III);Bis-(2,2,6,6-tetramethyl-3,5-heptandionato)manganese(III);Tris(2,2,6,6tetramethyl-3,5-heptanedionato)manganese(Ⅲ) | | CAS: | 14324-99-3 | | MF: | C33H57MnO6 | | MW: | 604.74 | | EINECS: | | | Product Categories: | ALD Precursors;metal beta-diketonate complexes | | Mol File: | 14324-99-3.mol |  |
| | MN(TMHD)3 Chemical Properties |
| Melting point | 165°C | | Boiling point | 255°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | black | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/3C11H20O2.Mn/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; | | InChIKey | ORZPLLPBZHORSD-LWTKGLMZSA-K | | SMILES | CC(C)(C)C(=O)\C=C(/O[Mn](O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | MN(TMHD)3 Usage And Synthesis |
| Uses | Catalyst for:
- Intramolecular Diels-Alder reactions
- Single electron donor for excess electron transfer studies in DNA
- Enantioselective synthesis
- Borylation reactions
- Hydrohydrazination and hydroazidation
- Oxidative carbonylation of phenol
| | reaction suitability | core: manganese
reagent type: catalyst | | Synthesis | To a mixture of manganese (II) sulfate monohydrate (1.5 g, 9 mmol, 1.0 eq) and 2,2,6,6-tetramethyl-3,5-heptanedione (5.0 g, , 27 mmol, 4.0 eq) in water (30 mL) and methanol (6 mL) was added dropwise a concentrated ammonia solution (12 ) at room temperature.
27 mmol, 4.0 eq) in a mixture of water (30 mL) and methanol (6 mL) were added dropwise to a concentrated ammonia solution (12 ), resulting in an immediate decrease in the amount of ammonia in the mixture.
mL), resulting in the immediate formation of a dark olive green/brown precipitate. The precipitate was filtered out, washed with water (3x10mL) and dried under vacuum for 24 hours to give Mn(dpm)3 (4.9 g, 90%). .
X-ray mass crystals of the complex were obtained from isopropanol, which showed the structure to be tris(2,2,6,6-tetramethyl-3,5-heptenoic acid) manganese in yield (4.9 g, 90%). |
| | MN(TMHD)3 Preparation Products And Raw materials |
|