- Diosgenin
-
- $10.50
-
2026-05-28
- CAS:512-06-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10 ton
- Diosgenin
-
- $200.00
-
2022-10-28
- CAS:512-06-1
- Min. Order: 1KG
- Purity: 95%HPLC
- Supply Ability: 20 tons
|
| | (20α,22R,25S)-Spirosta-5-ene-3β-ol Basic information |
| Product Name: | (20α,22R,25S)-Spirosta-5-ene-3β-ol | | Synonyms: | (20α,22R,25S)-Spirosta-5-ene-3β-ol;(25S)-Spirost-5-en-3β-ol;Nsc 226132;Spirost-5-en-3-ol, (3beta,25S)-;Neodiosgenin;Spirost-5-en-3-ol, (3β,25S)-;Yamogenin-RM;Yamogenin, 10 mM in DMSO | | CAS: | 512-06-1 | | MF: | C27H42O3 | | MW: | 414.62 | | EINECS: | 208-134-3 | | Product Categories: | Herb extract | | Mol File: | 512-06-1.mol |  |
| | (20α,22R,25S)-Spirosta-5-ene-3β-ol Chemical Properties |
| Melting point | >180°C (dec.) | | Boiling point | 527.1±50.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly), Pyridine | | form | Solid | | pka | 15.02±0.70(Predicted) | | color | White to Pale Beige | | Major Application | food and beverages | | InChIKey | WQLVFSAGQJTQCK-MIRLUMJSSA-N | | SMILES | C[C@@H]1CO[C@]2([C@@H](C)[C@H]3[C@H](C[C@@H]4C3(C)CC[C@H]3[C@H]4CC=C4[C@]3(C)CC[C@H](O)C4)O2)CC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (20α,22R,25S)-Spirosta-5-ene-3β-ol Usage And Synthesis |
| Uses | Yamogenin is a sapogenin compound found in the plant amber fenugreek, with steroid framework, that maintains antidiabetogenic activity. They also provide framework for the synthesis of a potential inhibitor of metallo-β-lactamase-1 which is a major target in the treatment of diseases involving gram-negative bacteria. | | Definition | ChEBI: Yamogenin is a triterpenoid. |
| | (20α,22R,25S)-Spirosta-5-ene-3β-ol Preparation Products And Raw materials |
|