|
|
| | 2-Bromo-5-fluoro-6-methylpyridine Basic information |
| | 2-Bromo-5-fluoro-6-methylpyridine Chemical Properties |
| Melting point | 63-65°C | | Boiling point | 183.4±35.0 °C(Predicted) | | density | 1.592±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -0.91±0.10(Predicted) | | color | Brown | | InChI | InChI=1S/C6H5BrFN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3 | | InChIKey | BFQONZCQHGIKIY-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Br)=CC=C1F | | CAS DataBase Reference | 374633-38-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22-41-37/38-22 | | Safety Statements | 26-36/37/39-36-39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-5-fluoro-6-methylpyridine Usage And Synthesis |
| Uses | 2-Bromo-5-fluoro-6-methylpyridine could be used to synthesize LY3295668, which is a potent, orally active and highly specific Aurora-A kinase inhibitor.
|
| | 2-Bromo-5-fluoro-6-methylpyridine Preparation Products And Raw materials |
|