- Biotin-PEG6-COOH
-
-
2025-06-07
- CAS:1352814-10-8
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | 21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid Basic information |
| Product Name: | 21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid | | Synonyms: | 21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid;21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid >=97% (HPLC);Biotin-PEG6-Acid;(+)-Biotin-PEG6-CH2CH2COOH;4,7,10,13,16,19-Hexaoxa-22-azaheptacosanoic acid, 27-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-23-oxo-;23-oxo-27-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-4,7,10,13,16,19-hexaoxa-22-azaheptacosanoicacid;(+)-Biotin-PEG6-acid;Biotin-PEG6-CH2CH2COOH/4,7,10,13,16,19-Hexaoxa-22-azaheptacosanoic acid, 27-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-23-oxo- | | CAS: | 1352814-10-8 | | MF: | C25H45N3O10S | | MW: | 579.7 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1352814-10-8.mol | ![21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid Structure](CAS/20180808/GIF/1352814-10-8.gif) |
| | 21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid Chemical Properties |
| Boiling point | 818.4±65.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 4.28±0.10(Predicted) | | form | powder | | α-end | biotin | | Ω-end | carboxylic acid | | InChIKey | GHYXJSUVAMFUEB-HFMPRLQTSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1 |
| WGK Germany | 3 | | HS Code | 2918999090 | | Storage Class | 13 - Non Combustible Solids |
| | 21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid Usage And Synthesis |
| Description | Biotin-PEG6-acid is a biotin PEG reagent. The hydrophilic PEG spacer arm imparts water solubility that is transferred to the biotinylated molecule. | | Uses | Biotin-PEG6-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. | | reaction suitability | reaction type: Biotinylations reagent type: cross-linking reagent | | IC 50 | PEGs |
| | 21-[D(+)-Biotinylamino]-4,7,10,13,16,19-hexaoxaheneicosanoic acid Preparation Products And Raw materials |
|