| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Biotin-PEG7-Azide manufacturers
- Biotin-PEG7-azide
-
-
2025-06-07
- CAS:1334172-75-6
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Biotin-PEG7-Azide Basic information |
| Product Name: | Biotin-PEG7-Azide | | Synonyms: | Biotin-PEG7-Azide;Biotin-PEG7-N3;Biotin-dPEG(R)7-azide;Biotin-PEG7-CH2CH2N3;Biotin-dPEG??-azide;α-(2-azidoethyl)-ω-(2-(5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanamido)ethoxy)hexa(oxyethylene);Biotin-PEG7-CH2CH2N3/1H-Thieno[3,4-d]imidazole-4-pentanamide, N-(23-azido-3,6,9,12,15,18,21-heptaoxatricos-1-yl)hexahydro-2-oxo-, (3aS,4S,6aR)-;Biotin-PEG7-CH2CH2Azido | | CAS: | 1334172-75-6 | | MF: | C26H48N6O9S | | MW: | 620.76 | | EINECS: | | | Product Categories: | SiChem;peg | | Mol File: | 1334172-75-6.mol |  |
| | Biotin-PEG7-Azide Chemical Properties |
| storage temp. | -20°C | | form | solid or viscous liquid | | pka | 13.896±0.40(predicted) | | color | Off-white to light yellow | | InChIKey | WOMFFURCOFOFGG-UHFFFAOYSA-N | | SMILES | O=C1NC(C2N1)CSC2CCCCC(NCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O |
| WGK Germany | WGK 3 | | HS Code | 2942000090 | | Storage Class | 11 - Combustible Solids |
| | Biotin-PEG7-Azide Usage And Synthesis |
| Description | Biotin-PEG7-azide is PEG-containing click chemistry tool for biotinylation | | Uses | Biotin-PEG7-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. Biotin-PEG7-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | reaction suitability | reaction type: Biotinylations
reagent type: cross-linking reagent | | IC 50 | PEGs |
| | Biotin-PEG7-Azide Preparation Products And Raw materials |
|