| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- Thiol-PEG8-acid
-
-
2025-06-07
- CAS:866889-02-3
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | HS-PEG8-CH2CH2COOH Basic information |
| Product Name: | HS-PEG8-CH2CH2COOH | | Synonyms: | HS-PEG8-CH2CH2COOH;1-Mercapto-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid;O-(2-Carboxyethyl)-O'-(2-Mercaptoethyl)heptaethylene glycol >=95% (oligoMer purity);4,7,10,13,16,19,22,25-Octaoxaheptacosanoicacid, 27-mercapto-;HS-PEG8-CH2CH2COOH;Thio-PEG8-acid;Thiol-PEG8-propionic acid;SH-PEG8-COOH | | CAS: | 866889-02-3 | | MF: | C19H38O10S | | MW: | 458.56 | | EINECS: | | | Product Categories: | peg | | Mol File: | 866889-02-3.mol |  |
| | HS-PEG8-CH2CH2COOH Chemical Properties |
| Boiling point | 559.7±50.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | 1S/C19H38O10S/c20-19(21)1-2-22-3-4-23-5-6-24-7-8-25-9-10-26-11-12-27-13-14-28-15-16-29-17-18-30/h30H,1-18H2,(H,20,21) | | InChIKey | SKYJRDAORYSCAL-UHFFFAOYSA-N | | SMILES | OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCS |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | HS-PEG8-CH2CH2COOH Usage And Synthesis |
| Description | Thiol-PEG8-acid is a PEG linker containing a thiol group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The thiol group reacts with maleimide, OPSS, vinylsulfone and transition metal surfaces including gold, silver, etc. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | O-(2-Carboxyethyl)-O′-(2-mercaptoethyl)heptaethylene glycol can be used:
- To prepare near-infrared fluorochromes applicable in imaging techniques.
- To functionalize Au nanoparticles for optoelectronic applications.
- As a linker in the synthesis of antibody-functionalized Au nanoparticles for forensic applications.
| | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs |
| | HS-PEG8-CH2CH2COOH Preparation Products And Raw materials |
|