| Company Name: |
HASWELL Gold |
| Tel: |
13951186658 |
| Email: |
Haswellvip@gmail.com |
|
| | 1,2,3-Trithiane-4-pentanoic Acid Basic information |
| Product Name: | 1,2,3-Trithiane-4-pentanoic Acid | | Synonyms: | 1,2,3-Trithiane-4-pentanoic Acid;Thioctic Acid IMpurity A;1,2,3-Trithiane-4-Pentanoic Acid (Thioctic Acid IMpurity A);1,2,3-Trithiane-4-pentanoic Acid DISCONTINUED;Rac-Lipoic Acid Impurity A;5-(1,2,3-trithian-4-yl)pentanoic acid;6,8-Epitrithio-Octanoic Acid;6,8-epitrithio-octanoic aci 5-[(4RS)-1,2,3-trithian-4-yl]pentanoic acid | | CAS: | 1204245-29-3 | | MF: | C8H14O2S3 | | MW: | 238.39 | | EINECS: | | | Product Categories: | Heterocycles;Sulfur & Selenium Compounds | | Mol File: | 1204245-29-3.mol |  |
| | 1,2,3-Trithiane-4-pentanoic Acid Chemical Properties |
| Boiling point | 424.8±37.0 °C(Predicted) | | density | 1.277±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 4.74±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H14O2S3/c9-8(10)4-2-1-3-7-5-6-11-13-12-7/h7H,1-6H2,(H,9,10) | | InChIKey | NBMATVIMURBZTQ-UHFFFAOYSA-N | | SMILES | S1CCC(CCCCC(O)=O)SS1 |
| | 1,2,3-Trithiane-4-pentanoic Acid Usage And Synthesis |
| Uses | 1,2,3-Trithiane-4-pentanoic Acid is used in the process for preparation of thioctic acid with low solvent residue. |
| | 1,2,3-Trithiane-4-pentanoic Acid Preparation Products And Raw materials |
|