|
|
| | alpha-Bromo-2-chlorophenylacetic acid Basic information |
| | alpha-Bromo-2-chlorophenylacetic acid Chemical Properties |
| Melting point | 108-110°C | | InChI | InChI=1S/C8H6BrClO2/c9-7(8(11)12)5-3-1-2-4-6(5)10/h1-4,7H,(H,11,12) | | InChIKey | XHAPROULWZYBGA-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1Cl)C(Br)C(=O)O | | CAS DataBase Reference | 141109-25-3(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | alpha-Bromo-2-chlorophenylacetic acid Usage And Synthesis |
| Uses | alpha-Bromo-2-chlorophenylacetic acid is used as an intermediate in the drug clopidogrel. |
| | alpha-Bromo-2-chlorophenylacetic acid Preparation Products And Raw materials |
|