|
|
| | H-Gly-Pro-Ala-OH Basic information |
| Product Name: | H-Gly-Pro-Ala-OH | | Synonyms: | Gly-L-Pro-L-Ala-OH;Gly-Pro-Ala-OH;Gly-Pro-L-Ala-OH;Glycylprolylalanine;NSC 97941;GLYCYL-L-PROLYL-L-ALANINE;COLLAGENASE-SUBSTRATE COMPONENT B;N-(1-glycyl-L-prolyl)-alanine | | CAS: | 837-83-2 | | MF: | C10H17N3O4 | | MW: | 243.26 | | EINECS: | 212-654-6 | | Product Categories: | | | Mol File: | 837-83-2.mol |  |
| | H-Gly-Pro-Ala-OH Chemical Properties |
| Melting point | >174°C (dec.) | | density | 1.330 | | storage temp. | -20°C | | solubility | Methanol (Slightly, Heated), Water (Slightly, Sonicated) | | form | Powder | | color | White | | BRN | 5288874 | | Stability: | Hygroscopic | | InChI | 1S/C10H17N3O4/c1-6(10(16)17)12-9(15)7-3-2-4-13(7)8(14)5-11/h6-7H,2-5,11H2,1H3,(H,12,15)(H,16,17)/t6-,7-/m0/s1 | | InChIKey | GGLIDLCEPDHEJO-BQBZGAKWSA-N | | SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C(=O)CN)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-Gly-Pro-Ala-OH Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | H-Gly-Pro-Ala-OH is used in the preparation of preventive medicine improvement medicine of gingivitis. | | Definition | ChEBI: Gly-Pro-Ala is a peptide. |
| | H-Gly-Pro-Ala-OH Preparation Products And Raw materials |
|