- BOC-LEU-OSU
-
- $1.00 / 1Kg
-
2024-07-20
- CAS:3392-09-4
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | BOC-LEU-OSU Basic information |
| Product Name: | BOC-LEU-OSU | | Synonyms: | N-ALPHA-T-BOC-L-LEUCINE N-HYDROXYSUCCINIMIDE ESTER;N-TERT-BUTOXYCARBONYL-L-LEUCINE-N-HYDROXYSUCCINIMIDE ESTER;BOC-LEU-OSU;BOC-LEUCINE-OSU;BOC-L-LEUCINE N-HYDROXYSUCCINIMIDE ESTER;BOC-L-LEUCINE HYDROXYSUCCINIMIDE ESTER;2,5-dioxopyrrolidin-1-yl (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-methylpentanoate;BOC-L-Leucine Osu | | CAS: | 3392-09-4 | | MF: | C15H24N2O6 | | MW: | 328.36 | | EINECS: | 222-232-3 | | Product Categories: | Amino Acid Derivatives;AMINOACIDS DERIVATIVES | | Mol File: | 3392-09-4.mol |  |
| | BOC-LEU-OSU Chemical Properties |
| Melting point | 110-113 °C(lit.) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 10.81±0.46(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 43.5±1°, c = 1% in dioxane | | BRN | 4538026 | | InChI | InChI=1S/C15H24N2O6/c1-9(2)8-10(16-14(21)22-15(3,4)5)13(20)23-17-11(18)6-7-12(17)19/h9-10H,6-8H2,1-5H3,(H,16,21)/t10-/m0/s1 | | InChIKey | WXRGJQZMGGGTSS-JTQLQIEISA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)[C@H](CC(C)C)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 3392-09-4(CAS DataBase Reference) |
| | BOC-LEU-OSU Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-LEU-OSU Preparation Products And Raw materials |
|