| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Boc-NVal-OH
-
-
2026-09-11
- CAS:53308-95-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- BOC-NVA-OH
-
- $100.00
-
2019-07-06
- CAS:53308-95-5
- Min. Order: 1KG
- Purity: 99%
|
| | BOC-NVA-OH Basic information |
| | BOC-NVA-OH Chemical Properties |
| Melting point | 43-47 °C | | Boiling point | 357.82°C (rough estimate) | | density | 1.1518 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Sealed in dry,2-8°C | | form | powder to crystal | | pka | 4.02±0.20(Predicted) | | color | White to Light yellow | | BRN | 3607582 | | Major Application | peptide synthesis | | InChI | 1S/C10H19NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 | | InChIKey | INWOAUUPYIXDHN-ZETCQYMHSA-N | | SMILES | CCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29241990 | | Storage Class | 10 - Combustible liquids |
| | BOC-NVA-OH Usage And Synthesis |
| Chemical Properties | transparent solid | | Uses | BOC-L-Norvaline is used in the synthesis of α-amino acid ester prodrugs used as cytotoxic agents against human lung cancer. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-NVA-OH Preparation Products And Raw materials |
| Raw materials | Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester-->Carbamic acid, N-[(1R)-1-(hydroxymethyl)-2-(phenylsulfonyl)ethyl]-, 1,1-dimethylethyl ester-->L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-phenyl-, methyl ester-->D-Norvaline, N-[(1,1-diMethylethoxy)carbonyl]-, Methyl ester-->(2R)-2-BOC-AMINO-3-PHENYLSULFONYL-1-(2-TETRAHYDROPYRANYLOXY)PROPANE, 98-->BOC-SER(TOS)-OCH3-->Boc-L-serine methyl ester-->Di-tert-butyl dicarbonate-->L-Norvaline-->2-(tert-Butoxycarbonyloxyimino)-2-phenylacetonitrile | | Preparation Products | N-BOC-L-NORVALINE ETHYL ESTER |
|