| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
BOC-D-LEUCINOL 97 manufacturers
|
| | BOC-D-LEUCINOL 97 Basic information |
| Product Name: | BOC-D-LEUCINOL 97 | | Synonyms: | BOC-D-LEUCINOL 97;Boc-DL-Leucinol;(r)-n-(tert-butoxycarbonyl)leucinol;N-BOC-DL-LEUCINOL;ert-butylN-(1-hydroxy-4-methylpentan-2-yl)carbamate;BOC-D-LEUCINOL 97 USP/EP/BP;Carbamic acid, N-[1-(hydroxymethyl)-3-methylbutyl]-, 1,1-dimethylethyl ester;Boc-D-Leucinol | | CAS: | 142121-48-0 | | MF: | C11H23NO3 | | MW: | 217.31 | | EINECS: | | | Product Categories: | | | Mol File: | 142121-48-0.mol |  |
| | BOC-D-LEUCINOL 97 Chemical Properties |
| Boiling point | 213 °C (lit.) | | density | 0.983 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.449(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.11±0.46(Predicted) | | Optical Rotation | [α]20/D +26°, c = 2 in methanol | | Major Application | peptide synthesis | | InChI | 1S/C11H23NO3/c1-8(2)6-9(7-13)12-10(14)15-11(3,4)5/h8-9,13H,6-7H2,1-5H3,(H,12,14)/t9-/m1/s1 | | InChIKey | LQTMEOSBXTVYRM-SECBINFHSA-N | | SMILES | CC(C)C[C@H](CO)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | HS Code | 2924190090 | | Storage Class | 10 - Combustible liquids |
| | BOC-D-LEUCINOL 97 Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | (1) Di-tert-butyl dicarbonate (4.1 g) was slowly added to a solution of 2-amino-4-methylpentan-1-ol (2.0 g) in tetrahydrofuran (THF, 40 mL) and the reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, the solvent was removed by distillation under reduced pressure and the resulting residue was washed with a solvent mixture of hexane/ethyl acetate (5:1, v/v) to afford the white solid product tert-butyl (1-hydroxy-4-methylpentan-2-yl)carbamate (3.7 g, yield XX%). The product was analyzed by electrospray ionization mass spectrometry (ESI-MS) showing m/z: 240 ([M + Na]+), which is consistent with the expected molecular weight. | | References | [1] Patent: US2013/331571, 2013, A1. Location in patent: Paragraph 0179; 0180 |
| | BOC-D-LEUCINOL 97 Preparation Products And Raw materials |
|