- Z-D-LYS-OH
-
- $11.00
-
2019-07-06
- CAS:70671-54-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- Z-D-LYS-OH
-
- $7.00
-
2019-07-06
- CAS: 70671-54-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | Z-D-Lys-OH Basic information |
| | Z-D-Lys-OH Chemical Properties |
| Melting point | 218 °C | | Boiling point | 497.0±45.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.90±0.21(Predicted) | | form | Crystalline | | color | White | | Optical Rotation | 13.5556°(C=0.9035g/100ml 1N HCL) | | BRN | 5290234 | | Major Application | peptide synthesis | | InChI | 1S/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m1/s1 | | InChIKey | OJTJKAUNOLVMDX-GFCCVEGCSA-N | | SMILES | NCCCC[C@@H](NC(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 70671-54-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | Z-D-Lys-OH Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-D-Lys-OH Preparation Products And Raw materials |
|