|
|
| | 4-Chloro-7-(trifluoromethyl)quinoline Basic information |
| | 4-Chloro-7-(trifluoromethyl)quinoline Chemical Properties |
| Melting point | 69-71 °C(lit.) | | Boiling point | 265.5±35.0 °C(Predicted) | | density | 1.4120 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | chloroform: soluble25mg/mL, clear, colorless | | pka | 1.18±0.27(Predicted) | | form | Solid | | color | Light Beige to Beige | | InChI | 1S/C10H5ClF3N/c11-8-3-4-15-9-5-6(10(12,13)14)1-2-7(8)9/h1-5H | | InChIKey | LLRQVSZVVAKRJA-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc2c(Cl)ccnc2c1 | | CAS DataBase Reference | 346-55-4(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Chloro-7-(trifluoromethyl)quinoline(346-55-4) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Chloro-7-(trifluoromethyl)quinoline Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Chloro-7-(trifluoromethyl)quinoline is a reagent in the preparation of piperazinylquinolines as breast cancer inhibitors. |
| | 4-Chloro-7-(trifluoromethyl)quinoline Preparation Products And Raw materials |
|