- Fmoc-Thr(tBu)-OH
-
- $0.00 / 25Kg/Drum
-
2026-04-22
- CAS:71989-35-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kg
- Fmoc-Thr(tBu)-OH
-
- $0.00/ kg
-
2026-04-22
- CAS:71989-35-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | FMOC-O-tert-Butyl-L-threonine Basic information |
| | FMOC-O-tert-Butyl-L-threonine Chemical Properties |
| Melting point | 131-134 °C | | alpha | 40 º (c=1, chloroform) | | Boiling point | 520.91°C (rough estimate) | | density | 1.2197 (rough estimate) | | refractive index | 15 ° (C=1, AcOEt) | | storage temp. | 2-8°C | | solubility | almost transparency in Ethylacetate | | pka | 3.42±0.10(Predicted) | | form | Fine Fluffy Crystalline Powder | | color | White | | Optical Rotation | [α]20/D +16±1°, c = 1% in ethyl acetate | | BRN | 4581133 | | Major Application | peptide synthesis | | InChIKey | LZOLWEQBVPVDPR-VLIAUNLRSA-N | | SMILES | C(O)(=O)[C@H]([C@H](OC(C)(C)C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 71989-35-0(CAS DataBase Reference) |
| | FMOC-O-tert-Butyl-L-threonine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Fmoc-Thr(tBu)-OH can be used to synthesize chlorofusin analogues via solid phase peptide synthesis. Additionally, it can serve as a protecting group for both the amine and the hydroxyl functions in solid-phase synthesis of complex depsipeptides. | | General Description |
FMOC-O-tert-Butyl-L-threonine is a white crystalline powder that is commonly used as amino acid building block in peptide synthesis.
| | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-O-tert-Butyl-L-threonine Preparation Products And Raw materials |
|