| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) Basic information | | Reactions |
| Product Name: | (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) | | Synonyms: | (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-napthoyl);(S,S)TROST LIGAND(NAPHTHYL);min.94%rostligand(naphthyl);1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl);(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl),min.94%(S,S)-DACH-NaphthylTrostLigand;(S,S)-DACH-naphthyl Trost Ligand;(1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-napthoyl),94%;(1S,2S)-(-)-N,N'-Bis(2-diphenylphosphino-1-napthoyl)-1,2-diaminocyclohexane | | CAS: | 205495-66-5 | | MF: | C52H44N2O2P2 | | MW: | 790.88 | | EINECS: | | | Product Categories: | Chiral Nitrogen;DACH&Trost Series | | Mol File: | 205495-66-5.mol |  |
| | (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) Chemical Properties |
| Melting point | 232-237 °C | | alpha | -65.2° (c 1, CH3OH) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | pka | 13.43±0.40(Predicted) | | color | off-white | | Optical Rotation | [α]20/D -66.0°, c = 1 in methanol | | InChIKey | VXFKMKXTPXVEMU-ZYBCLOSLSA-N | | SMILES | O=C(N[C@H]1CCCC[C@@H]1NC(=O)c2c(ccc3ccccc23)P(c4ccccc4)c5ccccc5)c6c(ccc7ccccc67)P(c8ccccc8)c9ccccc9 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) Usage And Synthesis |
| | (1S,2S)-(-)-1,2-Diaminocyclohexane-N,N'-bis(2-diphenylphosphino-1-naphthoyl) Preparation Products And Raw materials |
|