- 4-TERT-BUTYL-O-XYLENE
-
- $1.00
-
2024-10-22
- CAS:73-97-0
- Min. Order: 1g
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | 4-TERT-BUTYL-O-XYLENE Basic information |
| Product Name: | 4-TERT-BUTYL-O-XYLENE | | Synonyms: | 1,2-dimethyl-4-(tert-butyl)-benzene;1,2-Dimethyl-4-tert-Butylbenzene;1-tert-Butyl-3,4-dimethylbenzene;3,4-Dimethyl-tert-butylbenzene;4-(1,1-dimethylethyl)-1,2-dimethyl-benzen;Benzene, 1,2-dimethyl-4-(1,1-dimethylethyl);Benzene, 4-(1,1-dimethylethyl)-1,2-dimethyl-;o-Xylene, 4-tert-butyl- | | CAS: | 7397-06-0 | | MF: | C12H18 | | MW: | 162.27 | | EINECS: | 625-953-5 | | Product Categories: | Industrial/Fine Chemicals;Arenes;Building Blocks;Organic Building Blocks | | Mol File: | 7397-06-0.mol |  |
| | 4-TERT-BUTYL-O-XYLENE Chemical Properties |
| Melting point | -25.43°C (estimate) | | Boiling point | 200-210 °C(lit.) | | density | 0.871 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.498(lit.) | | Fp | 180 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1925371 | | Henry's Law Constant | 5.8×10-4 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C12H18/c1-9-6-7-11(8-10(9)2)12(3,4)5/h6-8H,1-5H3 | | InChIKey | QRPPSTNABSMSCS-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(C(C)(C)C)C=C1C | | EPA Substance Registry System | Benzene, 4-(1,1-dimethylethyl)-1,2-dimethyl- (7397-06-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29029000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-TERT-BUTYL-O-XYLENE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 4-tert-Butyl-o-xylene may be used as a starting material in the synthesis of 1,2-bis(bromomethyl )-4-tert-butylbenzene. It may also be used as a solvent in the synthesis of 2,7-di-tert-butylcarbazole, via ring closure of 4,4μ-di-tert-butyl-2,2μ-diaminobiphenyl in the presence of Nafion-H. |
| | 4-TERT-BUTYL-O-XYLENE Preparation Products And Raw materials |
|