|
|
| | Desethyl chloroquine Basic information |
| | Desethyl chloroquine Chemical Properties |
| Melting point | 94-97C | | Boiling point | 173-175 °C(Press: 0.05 Torr) | | density | 1.138±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethyl Acetate (Slightly), Met | | form | Solid | | pka | 10.62±0.19(Predicted) | | color | Pale Yellow to Dark Yellow | | biological source | synthetic | | InChI | 1S/C16H22ClN3/c1-3-18-9-4-5-12(2)20-15-8-10-19-16-11-13(17)6-7-14(15)16/h6-8,10-12,18H,3-5,9H2,1-2H3,(H,19,20) | | InChIKey | MCYUUUTUAAGOOT-UHFFFAOYSA-N | | SMILES | ClC(C=C1)=CC2=C1C(NC(CCCNCC)C)=CC=N2 |
| WGK Germany | 3 | | HS Code | 2933497050 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Desethyl chloroquine Usage And Synthesis |
| Chemical Properties | DESETHYL CHLOROQUINE is Tan Solid | | Uses | Desethyl Chloroquine is the major product of the stereoselective human metabolism of Chloroquine, used for the therapy and prevention of malaria. It is a COVID19-related research product. | | Definition | ChEBI: Desethylchloroquine is an aminoquinoline. | | in vivo | Intraperitoneal injections of Chloroquine are administered to wild-type and Huntington's disease (Q175/Q175) mice. LC-MS/MS is used to compare the levels Chloroquine and its metabolites in blood, brain and muscle tissue. Concentrations of Chloroquine are lower (5-15M), but more stable in brain tissue compared to blood or muscle between 4 and 24 hours after the last dose. Levels of the active Chloroquine metabolite Desethyl chloroquine decreased in muscle and blood over the 24 hour post-injection period, while brain Desethyl chloroquine levels are lower and rose slightly over the same time frame[3]. | | IC 50 | Plasmodium; TLRs |
| | Desethyl chloroquine Preparation Products And Raw materials |
|