|
|
| | 2-HYDROXY-5-METHOXY-3-NITRO-BENZALDEHYDE Basic information |
| | 2-HYDROXY-5-METHOXY-3-NITRO-BENZALDEHYDE Chemical Properties |
| Melting point | 129-134°C | | Boiling point | 303.1±42.0 °C(Predicted) | | density | 1.456±0.06 g/cm3(Predicted) | | form | powder | | pka | 5.28±0.38(Predicted) | | InChI | 1S/C8H7NO5/c1-14-6-2-5(4-10)8(11)7(3-6)9(12)13/h2-4,11H,1H3 | | InChIKey | CCHTVTHOPTTYSY-UHFFFAOYSA-N | | SMILES | COc1cc(C=O)c(O)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 34549-69-4(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25-43 | | Safety Statements | 36/37-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
| | 2-HYDROXY-5-METHOXY-3-NITRO-BENZALDEHYDE Usage And Synthesis |
| Uses | 2-Hydroxy-5-methoxy-3-nitrobenzaldehyde is used in preparation of pyrimidine derivatives as VEGF receptor tyrosine kinase inhibitors useful in the treatment of cancer. |
| | 2-HYDROXY-5-METHOXY-3-NITRO-BENZALDEHYDE Preparation Products And Raw materials |
|