| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,5-Dimethoxy-3-nitrobenzoic acid Basic information |
| Product Name: | 2,5-Dimethoxy-3-nitrobenzoic acid | | Synonyms: | 2,5-DIMETHOXY-3-NITROBENZOIC ACID 99%;2,5-Dimethoxy-3-nitrobenzoic acid,99%;2,5-DIMETHOXY-1-NITROBENZOIC ACID;3-NITRO-2,5-DIMETHOXYBENZOIC ACID;3-NITROGENTISIC ACID DIMETHYL ETHER;2,5-DIMETHOXY-3-NITRO-BENZOATE;2,5-dimethoxy-3-nitrobenzaldehyde;2,5-Dimethoxy-3-nitrobenzoicAcid> | | CAS: | 17894-26-7 | | MF: | C9H9NO6 | | MW: | 227.17 | | EINECS: | | | Product Categories: | C9;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 17894-26-7.mol |  |
| | 2,5-Dimethoxy-3-nitrobenzoic acid Chemical Properties |
| Melting point | 183-187 °C (lit.) | | Boiling point | 368.87°C (rough estimate) | | density | 1.4777 (rough estimate) | | refractive index | 1.5800 (estimate) | | solubility | soluble in Methanol | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | 1S/C9H9NO6/c1-15-5-3-6(9(11)12)8(16-2)7(4-5)10(13)14/h3-4H,1-2H3,(H,11,12) | | InChIKey | QCJROOYLFVYZEP-UHFFFAOYSA-N | | SMILES | COc1cc(C(O)=O)c(OC)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 17894-26-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-Dimethoxy-3-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 2,5-Dimethoxy-3-nitrobenzoic acid is a substituted nitrobenzoic acid. | | General Description | 2,5-Dimethoxy-3-nitrobenzoic acid is a substituted nitrobenzoic acid. |
| | 2,5-Dimethoxy-3-nitrobenzoic acid Preparation Products And Raw materials |
|