- Triptophenolide
-
- $30.00 / 1mg
-
2025-09-30
- CAS:74285-86-2
- Min. Order:
- Purity: 98.07%
- Supply Ability: 10g
- Triptophenolide
-
- $0.00 / 25KG
-
2025-08-08
- CAS:74285-86-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | TRIPTOPHENOLIDE Basic information |
| Product Name: | TRIPTOPHENOLIDE | | Synonyms: | Triptophenolide (Hypolide;6-hydroxy-9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1-one;6-hydroxy-9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e]isobenzofuran-1-one;Triptophenolide, BR;HYPOLIDE;TRIPTOPHENOLIDE;Triptophenolide, 98%, from Tripterygium wilfordii Hook.f.;Hypolide (Triptophenolide) | | CAS: | 74285-86-2 | | MF: | C20H24O3 | | MW: | 312.4 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Heterocycles | | Mol File: | 74285-86-2.mol |  |
| | TRIPTOPHENOLIDE Chemical Properties |
| Melting point | 232-233℃ | | Boiling point | 490.0±45.0 °C(Predicted) | | density | 1.21 | | solubility | DMSO : 100 mg/mL (320.10 mM; Need ultrasonic) | | form | powder | | pka | 10.63±0.40(Predicted) | | color | Yellowish | | InChI | InChI=1S/C20H24O3/c1-11(2)12-4-6-16-14(18(12)21)5-7-17-15-10-23-19(22)13(15)8-9-20(16,17)3/h4,6,11,17,21H,5,7-10H2,1-3H3/t17-,20+/m0/s1 | | InChIKey | KPXIBWGPZSPABK-FXAWDEMLSA-N | | SMILES | O1C(=O)C2CC[C@@]3(C)[C@]([H])(C=2C1)CCC1=C3C=CC(C(C)C)=C1O |
| | TRIPTOPHENOLIDE Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Begonia, Tripterygium root bark. | | Uses | Used for content determination/identification/pharmacological experiments, etc. | | Definition | ChEBI: (3bR,9bS)-6-hydroxy-9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e]isobenzofuran-1-one is an oxo steroid. | | Biological Activity | Triptophenolide is a colorless crystal isolated from the ethyl acetate extraction site of Tripterygium wilfordii. | | target | | Target | Value | AR-WT
() | 260 nM | AR -T877A
() | 388 nM | AR-F876L
() | 480 nM |
|
| | TRIPTOPHENOLIDE Preparation Products And Raw materials |
|