- RHAPONTIN
-
- $10.00
-
2026-03-20
- CAS:155-58-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100 mt
- Rhapontin
-
- $45.00
-
2025-05-23
- CAS:155-58-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 tons
- Rhaponticin
-
-
2023-02-24
- CAS:155-58-8
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | RHAPONTIN Basic information |
| Product Name: | RHAPONTIN | | Synonyms: | 3,3',5-TRIHYDROXY-4'-METHOXY-STILBENE 3-O-BETA-D-GLUCOSIDE;4'-METHOXY-3,3',5-STILBENETRIOL-3-GLUCOSIDE;4'-METHOXY-3,3',5-STILBENETROL;3-hydroxy-5-[2-(3-hydroxy-4-methoxyphenyl)vinyl]phenyl-beta-D-glucopyranoside;RHAPONTIN;RHAPONTIN FROM RHUBARB ROOT;RHAPONTIN WITH HPLC;RHAPONTIN, TECH. | | CAS: | 155-58-8 | | MF: | C21H24O9 | | MW: | 420.41 | | EINECS: | 205-845-0 | | Product Categories: | Miscellaneous Natural Products;Cardioglycosides & Glycosides | | Mol File: | 155-58-8.mol |  |
| | RHAPONTIN Chemical Properties |
| Melting point | 236-240 °C | | alpha | D32 -59.5° (acetone) | | Boiling point | 457.61°C (rough estimate) | | density | 1.2828 (rough estimate) | | refractive index | 1.6230 (estimate) | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.16±0.10(Predicted) | | color | Brown | | Water Solubility | slightly soluble in water | | Merck | 13,8258 | | Stability: | Hygroscopic | | Major Application | food and beverages | | InChI | 1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 | | InChIKey | GKAJCVFOJGXVIA-DXKBKAGUSA-N | | SMILES | COc1ccc(\C=C\c2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O | | LogP | 0.680 (est) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 24/25-37/39-26 | | WGK Germany | 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | RHAPONTIN Usage And Synthesis |
| Chemical Properties | light beige powder | | Uses | Rhapontin is a stilbene derivative found in Rheum. It is an inhibitor of Tyrosinase which is responsible for the molting process in insects, undesirable browning of fruits and vegetables, and coloring of skin, hair, and eyes in animals. | | Definition | ChEBI: Trans-rhaponticin is a rhaponticin in which the double bond adopts a trans-configuration. It possesses a range of pharmacological activities including antitumour, antiinflammatory, antilipemic and neuroprotective activities. It has a role as an anti-inflammatory agent, a plant metabolite, a neuroprotective agent, an EC 2.3.1.85 (fatty acid synthase) inhibitor, an antineoplastic agent, an apoptosis inducer, an angiogenesis inhibitor, a hypoglycemic agent, an anti-allergic agent and an antilipemic drug. | | target | LDL |
| | RHAPONTIN Preparation Products And Raw materials |
|