|
|
| | 2-Amino-6-methoxybenzoic acid Basic information |
| | 2-Amino-6-methoxybenzoic acid Chemical Properties |
| Melting point | >85(dec.) | | Boiling point | 341.5±27.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 4.83±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,9H2,1H3,(H,10,11) | | InChIKey | DYZDIWNRWSNVPT-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(OC)C=CC=C1N | | CAS DataBase Reference | 53600-33-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 29225090 |
| | 2-Amino-6-methoxybenzoic acid Usage And Synthesis |
| Chemical Properties | Off-white to light yellow solid | | Uses | 2-Amino-6-methoxybenzoic acid is a reagent is the synthesis of Tasquinimod (T007820). Tasquinimod is an orally active antiangiogenic agent which may inhibit HDAC4 signalling. This affects cancer cell survival thus making this compound and anti-cancer agent. |
| | 2-Amino-6-methoxybenzoic acid Preparation Products And Raw materials |
|