| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 4-pentenoate Basic information |
| Product Name: | Methyl 4-pentenoate | | Synonyms: | 4-Pentenoic acid methyl ester, Allylacetic acid methyl ester, Methyl allylacetate;Methyl 4-pentenoate >=95.0% (GC);Allylacetic acid methyl ester;SKL511;methyl pent-4-enoate | | CAS: | 818-57-5 | | MF: | C6H10O2 | | MW: | 114.14 | | EINECS: | | | Product Categories: | | | Mol File: | 818-57-5.mol |  |
| | Methyl 4-pentenoate Chemical Properties |
| Boiling point | 125-126 °C | | density | 0.904±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.415 | | FEMA | 4353 | METHYL 4-PENTENOATE | | Fp | 29 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Odor | at 10.00 % in dipropylene glycol. green fruit | | Appearance | Colorless to light yellow Liquid | | Odor Type | green | | JECFA Number | 1616 | | InChI | InChI=1S/C6H10O2/c1-3-4-5-6(7)8-2/h3H,1,4-5H2,2H3 | | InChIKey | SHCSFZHSNSGTOP-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCC=C | | LogP | 1.45 |
| Hazard Codes | Xi | | Risk Statements | 10-36 | | Safety Statements | 26 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 3 | | HS Code | 2916199590 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 |
| | Methyl 4-pentenoate Usage And Synthesis |
| Chemical Properties | Colorless liquid; green fruity aroma. | | Uses | 4-Pentenoic Acid Methyl Ester is used in the preparation of 2,4-dienoates. | | Definition | ChEBI: Methyl 4-pentenoate is a fatty acid methyl ester. | | Aroma threshold values | Medium strength odor; recommend smelling in a 10.00% solution or less | | General Description | Methyl 4-pentenoate is an unsaturated methyl ester that is prepared by the esterification of 1-pentenoic acid with methanol. It undergoes amidation with formamide via acetone-initiated photochemical reaction to form a 1:1 adduct. The metathesis of methyl 4-pentenoate with different Mo(VI)alkylidene complexes have been reported. It acts as a chain transfer agent during the polymerization of exo,exo-5,6-bis(methoxymethyl)-7-oxabicyclo[2.2.1]hept-2-ene using RuII(H20)6(tos)2 (tos =p-toluenesulfonate) as a catalyst. |
| | Methyl 4-pentenoate Preparation Products And Raw materials |
|
|
Tag:Methyl 4-pentenoate(818-57-5)
Related Product Information
|
|
Ethyl chrysanthemumate
TETRADECENYLSUCCINIC ANHYDRIDE
Pyroporphyrin dimethyl ester
cis-1,2,3,6-Tetrahydrophthalic anhydride
Diethyl allylmalonate
ethyl 3-(2,2-dichlorovinyl)-2,2-dimethyl-1-cyclopropanecarboxylate
MESOPORPHYRIN IX DIMETHYL ESTER
Diethyl 1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
Allylacetic acid
DICUMAROL
Ethyl 2-methyl-4-pentenoate
DIETHYL DIALLYLMALONATE
N-HEXADECENYLSUCCINIC ANHYDRIDE
2-Dodecen-1-ylsuccinic anhydride
Diethyl 1,4-dihydro-2,4,6-trimethyl-3,5-pyridinedicarboxylate
cis-4,7,10,13,16,19-Docosahexaenoic acid methyl ester
(1S,5R)-(-)-2-Oxabicyclo[3.3.0]oct-6-en-3-one
Pentamethyl cyclopentadiene-1,2,3,4,5-pentacarboxylate
|