|
|
| | Trimethylsulfonium bromide Basic information |
| | Trimethylsulfonium bromide Chemical Properties |
| Melting point | 203°C | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | very faint turbidity | | BRN | 3556022 | | InChI | InChI=1S/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 | | InChIKey | GOTIICCWNAPLMN-UHFFFAOYSA-M | | SMILES | C[S+](C)C.[Br-] | | CAS DataBase Reference | 3084-53-5(CAS DataBase Reference) | | EPA Substance Registry System | Sulfonium, trimethyl-, bromide (3084-53-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Trimethylsulfonium bromide Usage And Synthesis |
| Uses | Trimethylsulfonium bromide is an important pharmaceutical intermediate and chemical raw material for the preparation of methylcobalamin and epoxy resins. Methylcobalamin is the active form of vitamin B12 and is used to treat peripheral neuropathy, diabetic neuropathy, and amyotrophic lateral sclerosis. |
| | Trimethylsulfonium bromide Preparation Products And Raw materials |
|