2,3-DIMETHOXYPHENETHYLAMINE manufacturers
|
| | 2,3-DIMETHOXYPHENETHYLAMINE Basic information |
| Product Name: | 2,3-DIMETHOXYPHENETHYLAMINE | | Synonyms: | 2,3-Dimethoxyphenethylamine ,98%;2,3-Dimethoxyphenethylamine 97%;RARECHEM AL BW 0356;2,3-DIMETHOXYPHENETHYLAMINE;2-(2,3-Dimethoxyphenyl)ethanamine;2-(2,3-dimethoxyphenyl)ethylamine;2,3-Dimethoxybenzeneethanamine;Benzeneethanamine, 2,3-dimethoxy- | | CAS: | 3213-29-4 | | MF: | C10H15NO2 | | MW: | 181.23 | | EINECS: | | | Product Categories: | Amines;C9 to C10;Nitrogen Compounds | | Mol File: | 3213-29-4.mol |  |
| | 2,3-DIMETHOXYPHENETHYLAMINE Chemical Properties |
| Boiling point | 261-262 °C(lit.) | | density | 1.178 g/mL | | refractive index | n20/D 1.5320(lit.) | | Fp | >230 °F | | pka | 9.72±0.10(Predicted) | | Specific Gravity | 1.09 | | InChI | InChI=1S/C10H15NO2/c1-12-9-5-3-4-8(6-7-11)10(9)13-2/h3-5H,6-7,11H2,1-2H3 | | InChIKey | XKBUFTXNLBWTFP-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=CC(OC)=C1OC | | CAS DataBase Reference | 3213-29-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | HazardClass | AIR SENSITIVE, CORROSIVE | | HS Code | 29214990 | | Storage Class | 8B - Non-combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,3-DIMETHOXYPHENETHYLAMINE Usage And Synthesis |
| Uses | 2,3-Dimethoxyphenethylamine may be used in the synthesis of N-(2,3-dimethoxyphenethyl)-2-(3,4-dimethoxyphenyl)acetamide and N-(3,4-dimethoxyphenethyl)-phenyl acetamide. | | General Description | 2,3-Dimethoxyphenethylamine is identified as one of the components in bamboo (Phyllostachys pubescens) plant extract by gas chromatographic- mass spectrometric analysis. 1-(2,3-dimethoxyphenyl)-2-nitroethene undergoes reduction reaction with lithium aluminum hydride (LiAlH4) in the presence of dry tetrahydrofuran to yield 2,3-dimethoxyphenethylamine. |
| | 2,3-DIMETHOXYPHENETHYLAMINE Preparation Products And Raw materials |
|