| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Methoxyphenethylamine Basic information |
| | 3-Methoxyphenethylamine Chemical Properties |
| Boiling point | 118-119 °C/6 mmHg (lit.) | | density | 1.038 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.538(lit.) | | Fp | >230 °F | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Sparingly) | | form | Liquid | | pka | 9.96±0.10(Predicted) | | Specific Gravity | 1.04 | | color | Yellow | | Water Solubility | Insoluble | | BRN | 775202 | | InChI | InChI=1S/C9H13NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5-6,10H2,1H3 | | InChIKey | WJBMRZAHTUFBGE-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=CC(OC)=C1 | | CAS DataBase Reference | 2039-67-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Methoxyphenethylamine(2039-67-0) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | RTECS | SH7835000 | | F | 34 | | HazardClass | 8 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29222990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B | | Toxicity | mouse,LDLo,intraperitoneal,230mg/kg (230mg/kg),LUNGS, THORAX, OR RESPIRATION: RESPIRATORY STIMULATIONBEHAVIORAL: EXCITEMENT,Journal of Physiology. Vol. 76, Pg. 224, 1932. |
| | 3-Methoxyphenethylamine Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 3-Methoxyphenethylamine was used in the perfluorooctanesulfonic acid catalyzed Pictet-Spengler reaction. It was also used in the synthesis of 1,3-oxazepines via palladium-catalyzed intramolecular coupling. | | General Description | The spectral binding affinity for 3-methoxyphenethylamine was studied to examine the determinants of P450 2D6 catalysis. |
| | 3-Methoxyphenethylamine Preparation Products And Raw materials |
|