- HYPOCRELLIN B
-
- $52.00 / 1mg
-
2026-03-13
- CAS:123940-54-5
- Min. Order:
- Purity: 98.87%
- Supply Ability: 10g
- Hypocrellin B
-
- $0.00 / 5mg
-
2023-02-24
- CAS:123940-54-5
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Hypocrellin B
-
- $20.00 / 1Kg/Bag
-
2020-11-18
- CAS:123940-54-5
- Min. Order: 25Kg/Bag
- Purity: 99%
- Supply Ability: 20 Tons
|
| | HYPOCRELLIN B Basic information |
| Product Name: | HYPOCRELLIN B | | Synonyms: | HYPOCRELLIN B;HYPOCRELLIN B, HYPOCRELLA BAMBUSAE;HC-B;1H-Cyclohepta[ghi]perylene- 5,12-dione, 3-acetyl-6,11-dihydroxy-4, 8,9,13-tetramethoxy-2-methyl-;13-Acetyl-3,8-dihydroxy-1,5,6,10-tetramethoxy-12-methyl-2H-cyclohepta[ghi]perylene-2,9(11H)-dione | | CAS: | 123940-54-5 | | MF: | C30H24O9 | | MW: | 528.51 | | EINECS: | 213-551-9 | | Product Categories: | | | Mol File: | 123940-54-5.mol |  |
| | HYPOCRELLIN B Chemical Properties |
| Melting point | 261-263℃ | | Boiling point | 893.8±65.0 °C(Predicted) | | density | 1.52±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C | | solubility | DMF: soluble; DMSO: soluble | | pka | 6.62±0.40(Predicted) | | form | A crystalline solid | | color | Brown to black | | InChIKey | KPGRZWCQXQUGHK-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C3C4=C5C6C(=C(OC)C=C(O)C=62)C(OC)=CC5=C(O)C(=O)C(OC)=C4CC(C)=C3C(C(C)=O)=C1OC |
| | HYPOCRELLIN B Usage And Synthesis |
| Chemical Properties | Yellow crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Bamboo Red Fungus. | | Uses | Hypocrellin B is an apoptosis inducer. | | in vivo | Hypocrellin B (2 mg/kg, i.v.) inhibits tumor growth in A549 tumor bearing mice, but the anticancer efficacy is less than hypocrellin B loaded nanoparticles[4].
| | IC 50 | Leishmania |
| | HYPOCRELLIN B Preparation Products And Raw materials |
|