|
|
| | 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Basic information |
| | 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical Properties |
| Melting point | 123-127 °C(lit.) | | Boiling point | 187℃ | | density | 1.04g/cm3 | | bulk density | 300kg/m3 | | vapor pressure | <1 hPa | | refractive index | 1.4480 (estimate) | | Fp | 195°C(383°F) | | storage temp. | Store below +30°C. | | solubility | 0.007mg/l practically insoluble | | form | White to off-white solid. | | pka | 11.32±0.48(Predicted) | | color | White to Off-White | | PH | 4-7 (H2O, 20℃)(aqueous suspension) | | Water Solubility | 7μg/L at 20℃ | | Henry's Law Constant | 1.2×106 mol/(m3Pa) at 25℃, HSDB (2015) | | Cosmetics Ingredients Functions | ANTIOXIDANT | | InChI | 1S/C23H32O2/c1-14-9-16(20(24)18(11-14)22(3,4)5)13-17-10-15(2)12-19(21(17)25)23(6,7)8/h9-12,24-25H,13H2,1-8H3 | | InChIKey | KGRVJHAUYBGFFP-UHFFFAOYSA-N | | SMILES | Cc1cc(Cc2cc(C)cc(c2O)C(C)(C)C)c(O)c(c1)C(C)(C)C | | LogP | 6.25 at 20℃ | | CAS DataBase Reference | 119-47-1(CAS DataBase Reference) | | NIST Chemistry Reference | Phenol, 2,2'-methylenebis[6-(1,1-dimethylethyl)-4-methyl-(119-47-1) | | EPA Substance Registry System | 2,2'-Methylenebis(6-tert-butyl-p-cresol) (119-47-1) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36-62-53 | | Safety Statements | 26-36-60-36/37 | | WGK Germany | 1 | | RTECS | PA3500000 | | Autoignition Temperature | 350 °C | | TSCA | TSCA listed | | HS Code | 29072900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B | | Hazardous Substances Data | 119-47-1(Hazardous Substances Data) | | Toxicity | LD50 orally in Rabbit: 4880 mg/kg LD50 dermal Rabbit > 2000 mg/kg |
| | 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Usage And Synthesis |
| Chemical Properties | Pure product is white powder, slightly yellowish pink color when exposed to air for a long time. Slightly phenolic odor. Easily soluble in benzene, acetone and other organic solvents, insoluble in water, solubility in rubber is higher than 2%. | | Uses | LOWINOX® 22M46 stabilizer is a non-discoloring antioxidant based on a sterically hindered alkylated bis-phenol. | | Uses | It may be incorporated into the bromobutyl rubber(BIIR) matrix to enhance the overall thermo-reversibility of dicyclopentadiene dicarboxylic acid (DCPDCA) cross-linked BIIR. It may also be used as an antioxidant which shows a higher oxidation stability in distilled biodiesel. | | Definition | ChEBI: 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) is a diarylmethane. | | General Description | 2,2′-Methylenebis(6-tert-butyl-4-methylphenol) is a phenolic antioxidant commonly used in increasing the oxidation stability in rubber and plastic industries. | | Flammability and Explosibility | Not classified | | Industrial uses | 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) is used in the following products: adhesives and sealants, lubricants and greases, fuels, hydraulic fluids and metal working fluids. | | Source | 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) is a natural product found in Streptomyces and Aspergillus fumigatus with data available. | | Properties and Applications |
|
TEST ITEMS
|
SPECIFICATION
|
|
APPEARANCE
|
COLORLESS CRYSTALLINE POWDER
|
|
CONTENT
|
98.0% min
|
|
MELTING POINT
|
124 °C +
|
|
MELTING RANGE
|
120-130 °C
|
|
VOLATILE
|
0.3% max
|
|
ASH
|
0.1% max
|
|
150um SIEVE RESIDUE
|
0.5% max
|
|
| | 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Preparation Products And Raw materials |
|