|
|
| | 2,4-Dichloro-3-methylaniline Basic information |
| Product Name: | 2,4-Dichloro-3-methylaniline | | Synonyms: | Benzenamine, 2,4-dichloro-3-methyl-;Einecs 243-371-6;(2,4-dichloro-3-methylphenyl)amine(SALTDATA: HCl);2,4-dichloro-m-toluidine;(2,4-dichloro-3-methylphenyl)amine hydrochloride;2,4-Dichloro-3-Methyl-phenylaMine;2,4-dichloro-3-methylaniline hydrochloride;2,4-DICHLORO-3-METHYLANILINE | | CAS: | 19853-79-3 | | MF: | C7H7Cl2N | | MW: | 176.04 | | EINECS: | 243-371-6 | | Product Categories: | | | Mol File: | 19853-79-3.mol |  |
| | 2,4-Dichloro-3-methylaniline Chemical Properties |
| Boiling point | 258.9±35.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.14±0.10(Predicted) | | form | solid | | Appearance | Light yellow to gray Solid | | InChI | 1S/C7H7Cl2N.ClH/c1-4-5(8)2-3-6(10)7(4)9;/h2-3H,10H2,1H3;1H | | InChIKey | IVGZBIIHDPPDST-UHFFFAOYSA-N | | SMILES | ClC1=C(C)C(Cl)=CC=C1N.[H]Cl | | EPA Substance Registry System | Benzenamine, 2,4-dichloro-3-methyl- (19853-79-3) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2,4-Dichloro-3-methylaniline Usage And Synthesis |
| Uses | 2,4-Dichloro-3-methylaniline is a derivative of m-Toluidine (MT), which is a precursor to the pesticides metolachlor and acetochlor.
|
| | 2,4-Dichloro-3-methylaniline Preparation Products And Raw materials |
|