|
|
| | Glycinecarbonatesodiumsalt Basic information | | Uses |
| Product Name: | Glycinecarbonatesodiumsalt | | Synonyms: | DI-SGC;Glycinecarbonatesodiumsalt;Glycine monosodium salt carbonate;Glycine sodium salt carbonate;MONO-SGC;Sodium Glycine Carbonate(Mono-SGC);Diglycine sodium carbonate(Di-SGC);trisodium 2-aminoacetate carbonate | | CAS: | 50610-34-9 | | MF: | C3H4NNa3O5 | | MW: | 203.03687 | | EINECS: | | | Product Categories: | | | Mol File: | 50610-34-9.mol |  |
| | Glycinecarbonatesodiumsalt Chemical Properties |
| InChI | InChI=1S/C2H5NO2.CH2O3.3Na/c3-1-2(4)5;2-1(3)4;;;/h1,3H2,(H,4,5);(H2,2,3,4);;;/q;;3*+1/p-3 | | InChIKey | LFGIOTBVQMMVBC-UHFFFAOYSA-K | | SMILES | [Na+].[Na+].[Na+].C([O-])(=O)CN.C([O-])(=O)[O-] |
| | Glycinecarbonatesodiumsalt Usage And Synthesis |
| Uses | In the pharmaceutical industry, it is used to prepare effervescent tablets, neutralize stomach acid, solubilize poorly soluble acidic drugs, and as a foaming agent in detergents. |
| | Glycinecarbonatesodiumsalt Preparation Products And Raw materials |
|