| Company Name: |
SINO High Goal Chemical Technology Co., Ltd. Gold
|
| Tel: |
021-57646680 18306277365 |
| Email: |
guoxin@chembiobanksh.com |
| Products Intro: |
Product Name:dl-3-hydroxynorvaline
CAS:2280-42-4
Purity:98% Package:5G; 10G; 25G;100G
|
|
| | dl-3-hydroxynorvaline Basic information |
| Product Name: | dl-3-hydroxynorvaline | | Synonyms: | α-amino-β-hydroxyvaleric acid;α-Amino-β-hydroxyvaleric acid, 2-Amino-3-hydroxypentanoic acid, 3-Hydroxy-2-aminopentanoic acid, DL-β-Hydroxynorvaline;2-amino-3-hydroxy-valeric acid;2-azanyl-3-hydroxy-pentanoic acid;3-Hydroxy-DL-norvaline;beta-Hydroxynorvaline;DL-2-Amino-3-hydroxyvaleric acid;Norvaline, 3-hydroxy- | | CAS: | 2280-42-4 | | MF: | C5H11NO3 | | MW: | 133.15 | | EINECS: | | | Product Categories: | | | Mol File: | 2280-42-4.mol |  |
| | dl-3-hydroxynorvaline Chemical Properties |
| Melting point | 231.2℃ | | Boiling point | 328.4±32.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 2.39±0.24(Predicted) | | form | powder | | color | white | | BRN | 1722350 | | Major Application | cell analysis | | InChI | InChI=1S/C5H11NO3/c1-2-3(7)4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9)/t3,4-/m0/s1 | | InChIKey | LGVJIYCMHMKTPB-BKLSDQPFSA-N | | SMILES | C(O)(=O)[C@H](C(O)CC)N |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | dl-3-hydroxynorvaline Usage And Synthesis |
| Uses | cell analysis | | Definition | ChEBI: A non-proteinogenic amino-acid derivative that is norvaline (2-aminopentanoic acid) in which a hydrogen at position 3 is replaced by a hydroxy group. | | Biochem/physiol Actions | 3-Hydroxynorvaline (HNV) is a microbial, α amino acid threonine analogue which has antiviral activity (herpes virus) and is toxic to mammalian cells (embryotoxic and teratogenic) presumably via incorporation into proteins. 3-Hydroxynorvaline may be used as an unnatural amino acid to study the fidelity of protein translation at the level of acyl-tRNA editing. 3-Hydroxynorvaline may also be used to study enzymes and molecules involved in threonine metabolism. |
| | dl-3-hydroxynorvaline Preparation Products And Raw materials |
|