- D-Glucosamic acid
-
- $3.00
-
2020-01-08
- CAS:3646-68-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | D-Glucosamic acid Basic information |
| | D-Glucosamic acid Chemical Properties |
| Melting point | 235-245 °C (dec.) | | Boiling point | 633.2±55.0 °C(Predicted) | | density | 1.618 g/cm3(Temp: -5 °C) | | refractive index | -15 ° (C=2.5, 1mol/L HCl) | | storage temp. | 2-8°C | | solubility | Water (Slightly, Heated and Sonicated) | | form | Solid | | pka | 2.17±0.34(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D -15.0 to -14.0 °, c =2.5% (w/v) in hydrochloric acid | | BRN | 1726033 | | InChI | 1S/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1 | | InChIKey | UFYKDFXCZBTLOO-TXICZTDVSA-N | | SMILES | N[C@H]([C@@H](O)[C@H](O)[C@H](O)CO)C(O)=O | | EPA Substance Registry System | D-Gluconic acid, 2-amino-2-deoxy- (3646-68-2) |
| WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | D-Glucosamic acid Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | D-Glucosamic Acid is a useful starting material for the synthesis of aldonic acids containing a free carboxyl group and having all hydroxyl functions esterified with a simple carboxylic acid are well established deriviatives | | Uses | D-Glucosaminic Acid is a useful starting material for the synthesis of aldonic acids containing a free carboxyl group and having all hydroxyl functions esterified with a simple carboxylic acid are well established deriviatives. | | Definition | ChEBI: 2-amino-2-deoxy-D-gluconic acid is hexanoic acid with four hydroxy groups at C-3, C-4, C-5, C-6, and an amino group at C-2. It has a role as a bacterial metabolite. It is functionally related to a D-gluconic acid. It is a conjugate acid of a 2-amino-2-deoxy-D-gluconate. It is a tautomer of a 2-amino-2-deoxy-D-gluconic acid zwitterion. | | IC 50 | Human Endogenous Metabolite |
| | D-Glucosamic acid Preparation Products And Raw materials |
|