|
|
| | 5-Nitrosalicylic acid Basic information |
| | 5-Nitrosalicylic acid Chemical Properties |
| Melting point | 228-230 °C(lit.) | | Boiling point | 316.77°C (rough estimate) | | density | 1,65 g/cm3 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.6280 (estimate) | | storage temp. | no restrictions. | | solubility | water: soluble1g in 1475ml(lit.) | | form | Liquid | | pka | pK1:2.12 (25°C) | | color | Clear yellow-beige to orange-brown | | Water Solubility | Soluble in water 1g/1475ml . | | Merck | 14,6631 | | BRN | 2213719 | | InChI | 1S/C7H5NO5/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,9H,(H,10,11) | | InChIKey | PPDRLQLKHRZIJC-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1O)[N+]([O-])=O | | LogP | 1.158 at 25℃ | | CAS DataBase Reference | 96-97-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-hydroxy-5-nitro- (96-97-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29182990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 5-Nitrosalicylic acid Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 5-Nitrosalicylic Acid is a salicylic acid derivative with anti-inflammatory effect against colitis. | | Definition | ChEBI: A monohydroxybenzoic acid in which the hydroxy group is ortho- to the carboxylic acid group and which has a nitro substituent para- to the phenolic hydroxy group. | | Synthesis Reference(s) | Tetrahedron Letters, 36, p. 2377, 1995 DOI: 10.1016/0040-4039(95)00281-G | | General Description | 2-Hydroxy-5-nitrobenzoic acid inhibits the activity of wild type-bovine low Mr protein tyrosine phosphatase. The inhibition constant has been evaluated. | | Flammability and Explosibility | Non flammable | | Purification Methods | Crystallise the acid from Me2CO (charcoal), then twice more from Me2CO alone, aqueous EtOH (m 234-236o) or H2O (m 232-233o). [Beilstein 10 III 197, 10 IV 255.] |
| | 5-Nitrosalicylic acid Preparation Products And Raw materials |
|