- 3-Nitrosalicylic acid
-
- $0.00 / 25kg
-
2025-12-01
- CAS:85-38-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 10000kgs
- 3-Nitrosalicylic acid
-
- $0.00 / 1KG
-
2022-02-19
- CAS:85-38-1
- Min. Order: 1KG
- Purity: 98.6%
- Supply Ability: 100 tons
|
| | 3-Nitrosalicylic acid Basic information |
| | 3-Nitrosalicylic acid Chemical Properties |
| Melting point | 142-147 °C | | Boiling point | 316.77°C (rough estimate) | | density | 1.6074 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | pka | pK1:1.87 (25°C) | | form | Solid | | color | Pale Beige to Beige | | Water Solubility | 1.3g/L(16 ºC) | | Merck | 14,6631 | | BRN | 2213132 | | InChI | InChI=1S/C7H5NO5/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,9H,(H,10,11) | | InChIKey | WWWFHFGUOIQNJC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC([N+]([O-])=O)=C1O | | CAS DataBase Reference | 85-38-1(CAS DataBase Reference) | | NIST Chemistry Reference | Salicylic acid, 3-nitro(85-38-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | VO5300000 | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Nitrosalicylic acid Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder | | Uses | A nitrohumic acid which has been shown to bind to Molybdenum to impart fertility to soil and water and is a key element in the activity of nitrogenase. | | Uses | 3-Nitrosalicylic acid (3NSA) is generally used as a corrosion inhibitor. It can be used as a supporting electrolyte for the electrodeposition of pyrrole on zinc for corrosion protection. 3NSA can also be used as a ligand for the synthesis of complexes with iron and aluminum for chelating therapy. |
| | 3-Nitrosalicylic acid Preparation Products And Raw materials |
|