|
|
| | Oxazine 4 perchlorate Basic information |
| Product Name: | Oxazine 4 perchlorate | | Synonyms: | LD 690 Perchlorate;3,7-bis(ethylamino)-2,8-dimethyl-phenoxazin-5-iuperchlorate;3,7-BIS(ETHYLAMINO)-2,8-DIMETHYLPHENOXAZIN-5-IUM PERCHLORATE;Oxazine 4 perchlorate, 99%, laser grade, pure;Oxazine 4 perchlorate, laser grade, pure;3,7-Bis(ethylamino)-2,8-dimethylphenoxazine-5-ium·perchlorate;LD-690;Oxzazine 4 | | CAS: | 41830-81-3 | | MF: | C18H22ClN3O5 | | MW: | 395.84 | | EINECS: | | | Product Categories: | | | Mol File: | 41830-81-3.mol |  |
| | Oxazine 4 perchlorate Chemical Properties |
| density | 1.3130 (rough estimate) | | refractive index | 1.6500 (estimate) | | form | powder to crystal | | color | Green to Dark green | | InChI | InChI=1S/C18H22N3O.ClHO4/c1-5-19-13-9-17-15(7-11(13)3)21-16-8-12(4)14(20-6-2)10-18(16)22-17;2-1(3,4)5/h7-10,19-20H,5-6H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 | | InChIKey | XGKKSRHVGKVDRH-UHFFFAOYSA-M | | SMILES | Cl([O-])(=O)(=O)=O.N(C1C(=CC2=NC3=CC(C)=C(NCC)C=C3[O+]=C2C=1)C)CC | | EPA Substance Registry System | Phenoxazin-5-ium, 3,7-bis(ethylamino)-2,8-dimethyl-, perchlorate (41830-81-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | TSCA | TSCA listed | | HS Code | 32049000 |
| Provider | Language |
|
ACROS
| English |
| | Oxazine 4 perchlorate Usage And Synthesis |
| Description | LD 690 Perchlorate is a potent inhibitor used in biomedicine for the detection and analysis of anions. Its application includes the study of ion transport mechanisms, as well as the drug research of various diseases related to impaired anion transport, such as cystic fibrosis. It plays a crucial role in biomedical research for understanding anion dysregulation and developing targeted therapeutics. | | Chemical Properties | green shiny powder |
| | Oxazine 4 perchlorate Preparation Products And Raw materials |
|