Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate manufacturers
|
| | Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate Basic information |
| Product Name: | Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate | | Synonyms: | (+-)-ethyln-benzoyl-n-(3,4-dichlorophenyl)-2-aminopropionate;2-(n-benzoyl-n-(3,4-dichlorophenyl))amino-,ethylester,(+-)-propionicaci;Alanine, N-benzoyl-N-(3,4-dichlorophenyl)-, ethyl ester, DL-;DL-Alanine, N-benzoyl-N-(3,4-dichlorophenyl)-, ethyl ester;DL-alanine,N-benzoyl-N-(3,4-dichlorophenyl)-,ethylester;Endaven;Ethyl 2-(benzoyl-3,4-dichloroanilino)propanoate;2-(N-benzoyl-3,4-dichloroanilino)propanoic acid ethyl ester | | CAS: | 22212-55-1 | | MF: | C18H17Cl2NO3 | | MW: | 366.24 | | EINECS: | 244-845-5 | | Product Categories: | Pesticides&Metabolites;Growth regulatorsEnvironmental Standards;A-BPesticides&Metabolites;Alpha sort;BA - BHPesticides;Insecticides;AmideAlphabetic;B;BA - BHEnvironmental Standards;Herbicides;Metabolites | | Mol File: | 22212-55-1.mol | ![Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate Structure](CAS/GIF/22212-55-1.gif) |
| | Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate Chemical Properties |
| Melting point | 70.5°C | | Boiling point | 493.4±45.0 °C(Predicted) | | density | 1.3307 (rough estimate) | | refractive index | 1.6140 (estimate) | | pka | -1.87±0.50(Predicted) | | form | Crystalline Powder | | Water Solubility | 20mg/L(25 ºC) | | BRN | 2899940 | | Henry's Law Constant | 1.2×104 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C18H17Cl2NO3/c1-3-24-18(23)12(2)21(14-9-10-15(19)16(20)11-14)17(22)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 | | InChIKey | SLCGUGMPSUYJAY-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(C)N(C(=O)c1ccccc1)c2ccc(Cl)c(Cl)c2 | | NIST Chemistry Reference | Benzoylprop ethyl(22212-55-1) | | EPA Substance Registry System | Benzoylprop-ethyl (22212-55-1) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 24-60-61 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 3 | | RTECS | UE7550000 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 | | Toxicity | LD50 oral in rabbit: 1gm/kg |
| | Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate Usage And Synthesis |
| Description | Benzoylprop-ethyl is an obsolete herbicide once used to selectively control wild oats in a variety of field crops. Other than its moderate aqueous solubility, very little information has been published regarding its environmental fate, ecotoxicity nor its impact on human health. | | Uses | Benzoylprop-ethyl is used as a pesticide in agriculture. | | Definition | ChEBI: Benzoylprop-ethyl is a member of benzamides. | | Production Methods | The production process begins with the synthesis of benzoylprop, a propionic acid derivative containing a benzoyl and dichlorophenyl moiety. This acid is then reacted with ethanol in the presence of an acid catalyst to form the ethyl ester: ethyl 2-[N-benzoyl-N-(3,4-dichlorophenyl)amino]propionate. The reaction is typically carried out under reflux conditions to ensure complete esterification and high yield. | | Mechanism of action | Inhibition of lipid biosynthesis | | Pesticide Type | Herbicide |
| | Ethyl 2-[benzoyl-(3,4-dichlorophenyl)amino]propanoate Preparation Products And Raw materials |
|