|
|
| | L-ALANYL-L-TRYPTOPHAN Basic information |
| | L-ALANYL-L-TRYPTOPHAN Chemical Properties |
| Melting point | 260 °C | | Boiling point | 610.3±55.0 °C(Predicted) | | density | 1.338±0.06 g/cm3(Predicted) | | refractive index | 15 ° (C=2, H2O) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 3.16±0.10(Predicted) | | form | powder | | color | colorless to white | | Optical Rotation | [α]20/D +15.5±0.5°, c = 2.7% in H2O | | Water Solubility | almost transparency | | BRN | 4910138 | | Major Application | peptide synthesis | | InChI | 1S/C14H17N3O3/c1-8(15)13(18)17-12(14(19)20)6-9-7-16-11-5-3-2-4-10(9)11/h2-5,7-8,12,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,12-/m0/s1 | | InChIKey | WUGMRIBZSVSJNP-UFBFGSQYSA-N | | SMILES | C[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O | | CAS DataBase Reference | 16305-75-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2933.99.9701 | | Storage Class | 13 - Non Combustible Solids |
| | L-ALANYL-L-TRYPTOPHAN Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | Definition | ChEBI: A dipeptide formed from L-alanyl and L-tryptophan residues. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-ALANYL-L-TRYPTOPHAN Preparation Products And Raw materials |
|