- Boc-L-Tyr-Ome
-
-
2026-08-21
- CAS:4326-36-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Boc-L-Tyrosine methyl ester Basic information |
| | Boc-L-Tyrosine methyl ester Chemical Properties |
| Melting point | 100-104 °C(lit.) | | alpha | 51 º (c=1 in chloroform) | | Boiling point | 452.7±40.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | refractive index | 50 ° (C=1, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | pka | 9.75±0.15(Predicted) | | form | Powder or Crystalline Powder | | color | White to pale yellow | | Optical Rotation | [α]22/D +51°, c = 1 in chloroform | | Major Application | peptide synthesis | | InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(19)16-12(13(18)20-4)9-10-5-7-11(17)8-6-10/h5-8,12,17H,9H2,1-4H3,(H,16,19)/t12-/m0/s1 | | InChIKey | NQIFXJSLCUJHBB-LBPRGKRZSA-N | | SMILES | C(OC)(=O)[C@H](CC1=CC=C(O)C=C1)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 4326-36-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-Tyrosine methyl ester Usage And Synthesis |
| Chemical Properties | Colorless solid | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-Tyrosine methyl ester Preparation Products And Raw materials |
|