| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
Octaethylene glycol Monobenzyl ether manufacturers
- BnO-PEG8-OH
-
-
2026-07-10
- CAS:477775-73-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20Tons
- BnO-PEG8-OH
-
-
2026-01-28
- CAS:477775-73-8
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 300kg
|
| | Octaethylene glycol Monobenzyl ether Basic information | | Purity |
| Product Name: | Octaethylene glycol Monobenzyl ether | | Synonyms: | 2-[2-[2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;1-phenyl-2,5,8,11,14,17,20,23-octaoxapenta-cosan-25-ol, BnO-PEG8-OH;1-phenyl-2,5,8,11,14,17,20,23-octaoxapentacosan-25-ol;Octaethylene glycol Monobenzyl ether;2,5,8,11,14,17,20,23-Octaoxapentacosan-25-ol, 1-phenyl-;CAS_477775-73-8;Benzyl-PEG8-OH;HO-(CH2CH2O)8-Bn | | CAS: | 477775-73-8 | | MF: | C23H40O9 | | MW: | 460.56 | | EINECS: | | | Product Categories: | peg | | Mol File: | 477775-73-8.mol |  |
| | Octaethylene glycol Monobenzyl ether Chemical Properties |
| Boiling point | 541.6±45.0 °C(Predicted) | | density | 1.101±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.36±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C23H40O9/c24-6-7-25-8-9-26-10-11-27-12-13-28-14-15-29-16-17-30-18-19-31-20-21-32-22-23-4-2-1-3-5-23/h1-5,24H,6-22H2 | | InChIKey | KFJXPXAFUAPRSZ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)OCCOCCOCCOCCOCCOCCOCCOCCO |
| | Octaethylene glycol Monobenzyl ether Usage And Synthesis |
| Purity | ＞98% | | Description | Octaethylene glycol monobenzyl ether (CAS 477775-73-8), also known as benzyl-PEG8-alcohol, benzyl-PEG8-OH, BnO-PEG8-OH and benzyl-PEG8-alcohol, is a PEG linker. Its structure features a benzyl protecting group (which can be deprotected under catalytic hydrogenation conditions) and a primary hydroxyl group. This primary hydroxyl group is reactive and allows for further derivatisation of the compound. The PEG9 linker enhances the water solubility of the compound. | | Uses | Benzyl-PEG8-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | Octaethylene glycol Monobenzyl ether Preparation Products And Raw materials |
|