|
|
| | 1,1-Cyclohexanediacetic acid mono amide Basic information |
| | 1,1-Cyclohexanediacetic acid mono amide Chemical Properties |
| Melting point | 141-146 °C (lit.) | | Boiling point | 443.6±18.0 °C(Predicted) | | density | 1.135±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.72±0.10(Predicted) | | form | Solid | | color | White to Off-White | | biological source | human | | InChI | InChI=1S/C10H17NO3/c11-8(12)6-10(7-9(13)14)4-2-1-3-5-10/h1-7H2,(H2,11,12)(H,13,14) | | InChIKey | QJGSJXLCJRXTRY-UHFFFAOYSA-N | | SMILES | C1(CC(N)=O)(CC(O)=O)CCCCC1 | | LogP | 0.73 at 22℃ and pH3 | | CAS DataBase Reference | 99189-60-3(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 61 | | Safety Statements | 22-24/25-45-53 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | 1,1-Cyclohexanediacetic acid mono amide Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 1,1-Cyclohexanediacetic acid monoamide is an impurity of Gabapentin (G117250), an amino acid structurally related to γ-Aminobutyric Acid (GABA), designed to cross the blood brain barrier.Gabapentin is used as an anticonvulsant. | | General Description | 1,1-Cyclohexanediacetic acid monoamide, also known as gabapentin amide, has neurological properties. It is an important intermediate formed during the synthesis of a potential antiepileptic drug, gabapentin. |
| | 1,1-Cyclohexanediacetic acid mono amide Preparation Products And Raw materials |
|