| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
BOC-3-AMINOBENZOIC ACID manufacturers
|
| | BOC-3-AMINOBENZOIC ACID Basic information |
| Product Name: | BOC-3-AMINOBENZOIC ACID | | Synonyms: | H-ALPHA-T-BUTOXYCARBONYL-3-AMINOBENZOIC ACID;BOC-3-AMINOBENZOIC ACID;BOC-3-ABZ-OH;BOC-M-ABZ-OH;3-(n-Boc amino)benzoic acid;3-(TERT-BUTYLOXYCARBONYLAMINO)-BENZOIC ACID;3-(BOC-AMINO)BENZOIC ACID;N-ALPHA-T-BUTOXYCARBONYL-3-AMINOBENZOIC ACID | | CAS: | 111331-82-9 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 111331-82-9.mol |  |
| | BOC-3-AMINOBENZOIC ACID Chemical Properties |
| Melting point | 195 °C (dec.) | | Boiling point | 339.8±25.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.15±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 5813611 | | Major Application | peptide synthesis | | InChI | 1S/C12H15NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h4-7H,1-3H3,(H,13,16)(H,14,15) | | InChIKey | SAPAUOFSCLCQJB-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Nc1cccc(c1)C(O)=O | | CAS DataBase Reference | 111331-82-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | BOC-3-AMINOBENZOIC ACID Usage And Synthesis |
| Chemical Properties | Brown powder | | Uses | Boc-3-Abz-OH, is an intermediate in the synthesis of various pharmaceutical compounds, including inhibitors, and therapeutic agents. It can also be used in the preparation of conformationally-constrained cyclic peptides with biarylamine linkers. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | GENERAL METHOD: To a stirred solution of m-aminobenzoic acid (5.00 g, 36.5 mmol) and sodium hydroxide (1.56 g, 39.3 mmol) in a solvent mixture of 1:1 water/dioxane (60 mL) at 0 °C was slowly added di-tert-butyl dicarbonate (14.3 g, 65.4 mmol). The reaction mixture was continued to be stirred at 0 °C for 3 h, followed by slow warming to room temperature and stirring overnight. After completion of the reaction, the reaction mixture was extracted with ethyl acetate (60 mL) and the extraction was repeated once (60 mL). The organic phases were combined and neutralized with 1 M aqueous KHSO4 to pH ≈ 7. The organic layer was separated, washed with water (60 mL) and dried over anhydrous magnesium sulfate. The solvent was removed by concentration under reduced pressure to give 3-(N-Boc-amino)benzoic acid (7.53 g, 87% yield) as an off-white solid, which could be used in the next reaction without further purification. | | References | [1] Journal of Medicinal Chemistry, 2001, vol. 44, # 3, p. 441 - 452 [2] Tetrahedron, 2012, vol. 68, # 6, p. 1790 - 1801 [3] Patent: US2014/194383, 2014, A1. Location in patent: Paragraph 0500; 0507-0508 [4] Chemical Communications, 2013, vol. 49, # 66, p. 7340 - 7342 [5] Bioorganic and Medicinal Chemistry, 2018, |
| | BOC-3-AMINOBENZOIC ACID Preparation Products And Raw materials |
|