|
|
| | Eosin 5-isothiocyanate Basic information |
| Product Name: | Eosin 5-isothiocyanate | | Synonyms: | eosine-5-isothiocyanate;EITC;EOSIN 5-ISOTHIOCYANATE FOR FLUOR- &;EOSIN-5-ISOTHIOCYANATE, FOR FLUOR-ESCENC E;Spiroisobenzofuran-1(3H),9-9Hxanthen-3-one, 2,4,5,7-tetrabromo-3,6-dihydroxy-5-isothiocyanato-;Eosin 5-isothiocyanate-Celite(R);Eosin-5-isothiocyanate [2',4',5',7'-TetrabroMofluorescein-5-isothiocyanate];Eosin 5-isothiocyanate–Celite? | | CAS: | 60520-47-0 | | MF: | C21H7Br4NO5S | | MW: | 704.97 | | EINECS: | | | Product Categories: | | | Mol File: | 60520-47-0.mol |  |
| | Eosin 5-isothiocyanate Chemical Properties |
| Boiling point | 719.1±60.0 °C(Predicted) | | density | 2.33±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 6.93±0.20(Predicted) | | form | Solid | | color | Red to Dark Red | | Stability: | Light sensitive | | InChI | 1S/C21H7Br4NO5S/c22-12-4-10-14(8-2-1-7(26-6-32)3-9(8)21(29)30)11-5-13(23)18(28)16(25)20(11)31-19(10)15(24)17(12)27/h1-5,27H,(H,29,30) | | InChIKey | MCXYFYWNOWPDMA-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1C2=C3C=C(Br)C(=O)C(Br)=C3Oc4c(Br)c(O)c(Br)cc24)N=C=S |
| Hazard Codes | Xn | | Risk Statements | 42 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-9 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Resp. Sens. 1
Skin Sens. 1 |
| | Eosin 5-isothiocyanate Usage And Synthesis |
| Description | Eosine-5-isothiocyanate is an amine-reactive fluorescent probe for protein rotational diffusion measurement. | | Uses | Eosin 5-isothiocyanate (EITC) is a fluorescence probe. EITC tagged molecules may be used together with fluorescein-5′-isothiocyanate (FITC) tagged molecules in fluoresce resonance energy transfer (FRET) based assays. | | Uses | Acceptor fluorophore. Measurement of rotational diffusion of proteins; In fluorescence energy transfer studies: R. Wagner et al.; FEBS Lett. 230, 109 (1988) | | Definition | ChEBI: The 2',4',5',7'-tetrabromo-5-isothiocyanato derivative of fluorescein; exhibits phosphorescence with an emission maximum at ~680 nm. |
| | Eosin 5-isothiocyanate Preparation Products And Raw materials |
|